[1,1':4',1''-Terphenyl]-4,4''-dicarbonitrile, 97%
cas: 17788-93-1 — see every product listed under this CAS number, including other names
[1,1':4',1''-Terphenyl]-4,4''-dicarbonitrile, 97% (CAS 17788-93-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1351784-100mg |
| cas | 17788-93-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1738.75 Pln | |
| Ambeed | 25g | 7267.88 Pln | |
| Ambeed | 100g | 23805.19 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1869.37 Pln | |
| BLDpharm | 25g | 7828.38 Pln | |
| BLDpharm | 100g | 25660.99 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[4-(4-cyanophenyl)phenyl]benzonitrile (CAS 17788-93-1) is a chemical compound with the molecular formula C20H12N2 and a molecular weight of 280.3 g/mol. IUPAC name: 4-[4-(4-cyanophenyl)phenyl]benzonitrile. InChIKey: RFBQFWLDUKDOND-UHFFFAOYSA-N.
| Molecular formula | C20H12N2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 4-[4-(4-cyanophenyl)phenyl]benzonitrile |
| InChIKey | RFBQFWLDUKDOND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)