CAS 17788-93-1 appears in our catalog under these names: (1,1':4',1''–Terphenyl)–4,4''–dicarbonitrile, [1,1':4',1''-Terphenyl]-4,4''-dicarbonitrile, 98%, [1,1':4',1''-Terphenyl]-4,4''-dicarbonitrile, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
4-[4-(4-cyanophenyl)phenyl]benzonitrile (CAS 17788-93-1) is a chemical compound with the molecular formula C20H12N2 and a molecular weight of 280.3 g/mol. IUPAC name: 4-[4-(4-cyanophenyl)phenyl]benzonitrile. InChIKey: RFBQFWLDUKDOND-UHFFFAOYSA-N.
| Molecular formula | C20H12N2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 4-[4-(4-cyanophenyl)phenyl]benzonitrile |
| InChIKey | RFBQFWLDUKDOND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)