CAS 215-64-5 appears in our catalog under these names: Dibenzo[a,c]phenazine, >98.0%(HPLC)(qNMR), Dibenzo[a,c]phenazine, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 5g.
Phenanthro[9,10-b]quinoxaline (CAS 215-64-5) is a chemical compound with the molecular formula C20H12N2 and a molecular weight of 280.3 g/mol. IUPAC name: phenanthro[9,10-b]quinoxaline. InChIKey: KHPYJVQRBJJYSF-UHFFFAOYSA-N.
| Molecular formula | C20H12N2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | phenanthro[9,10-b]quinoxaline |
| InChIKey | KHPYJVQRBJJYSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=NC5=CC=CC=C5N=C24 |
Computed by PubChem (NCBI)