CAS 168289-77-8 is the registry number for 1,3-Bis(pyridin-4-ylethynyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-[3-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine (CAS 168289-77-8) is a chemical compound with the molecular formula C20H12N2 and a molecular weight of 280.3 g/mol. IUPAC name: 4-[2-[3-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine. InChIKey: XMENRJMGVOOPLI-UHFFFAOYSA-N.
| Molecular formula | C20H12N2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 4-[2-[3-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine |
| InChIKey | XMENRJMGVOOPLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#CC2=CC=NC=C2)C#CC3=CC=NC=C3 |
Computed by PubChem (NCBI)