CAS 73572-12-0 appears in our catalog under these names: (1,1'–Binaphthalen)–2–ol, [1,1'-Binaphthalen]-2-ol, 98%, 98%, [1,1'-Binaphthalen]-2-ol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-naphthalen-1-ylnaphthalen-2-ol (CAS 73572-12-0) is a chemical compound with the molecular formula C20H14O and a molecular weight of 270.3 g/mol. IUPAC name: 1-naphthalen-1-ylnaphthalen-2-ol. InChIKey: DVWQNBIUTWDZMW-UHFFFAOYSA-N.
| Molecular formula | C20H14O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 1-naphthalen-1-ylnaphthalen-2-ol |
| InChIKey | DVWQNBIUTWDZMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C(C=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)