CAS 146746-37-4 is the registry number for 2-(Anthracen-9-yl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-anthracen-9-ylphenol (CAS 146746-37-4) is a chemical compound with the molecular formula C20H14O and a molecular weight of 270.3 g/mol. IUPAC name: 2-anthracen-9-ylphenol. InChIKey: WBUYLCDLNQVTFK-UHFFFAOYSA-N.
| Molecular formula | C20H14O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 2-anthracen-9-ylphenol |
| InChIKey | WBUYLCDLNQVTFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C4=CC=CC=C4O |
Computed by PubChem (NCBI)