CAS 146746-40-9 is the registry number for (1,1'-Binaphthalen)-8-ol. Offered by: TRC. Available pack sizes: 250mg, 25mg, 50mg.
8-naphthalen-1-ylnaphthalen-1-ol (CAS 146746-40-9) is a chemical compound with the molecular formula C20H14O and a molecular weight of 270.3 g/mol. IUPAC name: 8-naphthalen-1-ylnaphthalen-1-ol. InChIKey: QYVLFKNPUCXXQJ-UHFFFAOYSA-N.
| Molecular formula | C20H14O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 8-naphthalen-1-ylnaphthalen-1-ol |
| InChIKey | QYVLFKNPUCXXQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=CC4=C3C(=CC=C4)O |
Computed by PubChem (NCBI)