CAS 5471-63-6 appears in our catalog under these names: 1,3–Diphenylisobenzofuran, 1,3-Diphenylisobenzofuran/ 99.25% (existing batch purity), 1,3-Diphenylisobenzofuran, 97% , 1,3-Diphenylisobenzofuran, 1,3-Diphenylisobenzofuran, >97.0%(GC). Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100mg, 1g, 500mg, 5g, 10g, 25g, 50g, 100g.
1,3-diphenyl-2-benzofuran (CAS 5471-63-6) is a chemical compound with the molecular formula C20H14O and a molecular weight of 270.3 g/mol. IUPAC name: 1,3-diphenyl-2-benzofuran. InChIKey: ZKSVYBRJSMBDMV-UHFFFAOYSA-N.
| Molecular formula | C20H14O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 1,3-diphenyl-2-benzofuran |
| InChIKey | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(O2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)