[1,1'-Biphenyl]-3-ylmethanol, 98%
cas: 69605-90-9 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-3-ylmethanol, 98% (CAS 69605-90-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A198425-250mg |
| cas | 69605-90-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 598.44 Pln | |
| Ambeed | 25g | 2400.69 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 642.02 Pln | |
| BLDpharm | 25g | 2580.23 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 617.51 Pln | |
| Fluorochem | 10g | 1153.78 Pln | |
| Fluorochem | 25g | 2465.82 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-phenylphenyl)methanol (CAS 69605-90-9) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: (3-phenylphenyl)methanol. InChIKey: WGUZZTGZDPJWSG-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | (3-phenylphenyl)methanol |
| InChIKey | WGUZZTGZDPJWSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CO |
Computed by PubChem (NCBI)