CAS 24875-94-3 is the registry number for 6'-Methyl-2'-acetonaphthone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(6-methylnaphthalen-2-yl)ethanone (CAS 24875-94-3) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 1-(6-methylnaphthalen-2-yl)ethanone. InChIKey: SPAYGOAEIJHIDE-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 1-(6-methylnaphthalen-2-yl)ethanone |
| InChIKey | SPAYGOAEIJHIDE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)