CAS 69605-90-9 appears in our catalog under these names: 3-Biphenylmethanol, 98%, 3-(Hydroxymethyl)biphenyl, >96.0%(GC), [1,1'-Biphenyl]-3-ylmethanol 98%, [1,1'-Biphenyl]-3-ylmethanol, 98%, 98%, [1,1'-Biphenyl]-3-ylmethanol, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg, 10g.
(3-phenylphenyl)methanol (CAS 69605-90-9) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: (3-phenylphenyl)methanol. InChIKey: WGUZZTGZDPJWSG-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | (3-phenylphenyl)methanol |
| InChIKey | WGUZZTGZDPJWSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CO |
Computed by PubChem (NCBI)