CAS 26191-64-0 appears in our catalog under these names: 4-(4-Methylphenyl)phenol, 98%, 4'-Methyl-[1,1'-biphenyl]-4-ol 98%, 4'-Methyl-[1,1'-biphenyl]-4-ol, 97%, 97%, 4'-Methyl[1,1'-biphenyl]-4-ol, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg, 100g.
4-(4-methylphenyl)phenol (CAS 26191-64-0) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 4-(4-methylphenyl)phenol. InChIKey: DDZACMDGXVXOOH-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 4-(4-methylphenyl)phenol |
| InChIKey | DDZACMDGXVXOOH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)