cas: 1234615-95-2 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[4,3-a]pyridine-5-carboxylic acid 95% (CAS 1234615-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746338-100mg |
| cas | 1234615-95-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 909.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A746338 |
[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid (CAS 1234615-95-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid. InChIKey: OEIZLOMSYUPULT-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
| InChIKey | OEIZLOMSYUPULT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)