cas: 1228879-30-8 — see every product listed under this CAS number, including other names
[1-(4-Fluorophenyl)cyclobutyl]methanamine, HCl (CAS 1228879-30-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110X7O-50mg |
| cas | 1228879-30-8 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 198.80 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1106.00 Pln |
| delivery time | 3 weeks |
|---|
[1-(4-fluorophenyl)cyclobutyl]methanamine;hydrochloride (CAS 1228879-30-8) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: [1-(4-fluorophenyl)cyclobutyl]methanamine;hydrochloride. InChIKey: NZJNWPNLFCLTSA-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFN |
|---|---|
| Molecular weight | 215.69 g/mol |
| IUPAC name | [1-(4-fluorophenyl)cyclobutyl]methanamine;hydrochloride |
| InChIKey | NZJNWPNLFCLTSA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)