Products 1391431-07-4
CAS 1391431-07-4 appears in our catalog under these names: (S)-2-(4-Fluorophenyl)piperidine hydrochloride, 95%, (S)-2-(4-Fluorophenyl)piperidine hydrochloride, 98%, (2S)-2-(4-fluorophenyl)piperidine,hydrochloride, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 50mg, 250mg.
(2S)-2-(4-fluorophenyl)piperidine;hydrochloride (CAS 1391431-07-4) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)piperidine;hydrochloride. InChIKey: YAVUREZBMQVFFY-MERQFXBCSA-N.
| Molecular formula | C11H15ClFN |
|---|---|
| Molecular weight | 215.69 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)piperidine;hydrochloride |
| InChIKey | YAVUREZBMQVFFY-MERQFXBCSA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)