CAS 1228880-30-5 appears in our catalog under these names: [1-(3-Fluorophenyl)cyclobutyl]methanamine hydrochloride, 98%, (1-(3-Fluorophenyl)cyclobutyl)methanamine hydrochloride, 98%, (1–(3–fluorophenyl)cyclobutyl)methanamine hydrochloride, [1-(3-Fluorophenyl)cyclobutyl]methanamine, HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
[1-(3-fluorophenyl)cyclobutyl]methanamine;hydrochloride (CAS 1228880-30-5) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: [1-(3-fluorophenyl)cyclobutyl]methanamine;hydrochloride. InChIKey: YUQRPATZUVPEHE-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFN |
|---|---|
| Molecular weight | 215.69 g/mol |
| IUPAC name | [1-(3-fluorophenyl)cyclobutyl]methanamine;hydrochloride |
| InChIKey | YUQRPATZUVPEHE-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)