Products 1225335-98-7

CAS 1225335-98-7 is the registry number for 1-(2-Fluorophenyl)cyclopentan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)cyclopentan-1-amine;hydrochloride (CAS 1225335-98-7) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopentan-1-amine;hydrochloride. InChIKey: RRIJAXVEZGFZBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClFN
Molecular weight215.69 g/mol
IUPAC name1-(2-fluorophenyl)cyclopentan-1-amine;hydrochloride
InChIKeyRRIJAXVEZGFZBJ-UHFFFAOYSA-N
SMILESC1CCC(C1)(C2=CC=CC=C2F)N.Cl

Computed by PubChem (NCBI)