cas: 128143-88-4 — see every product listed under this CAS number, including other names
[2,2':6',2''-Terpyridin]-4'(1'H)-one, 95% (CAS 128143-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340065-250MG |
| cas | 128143-88-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 320.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dipyridin-2-yl-1H-pyridin-4-one (CAS 128143-88-4) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 2,6-dipyridin-2-yl-1H-pyridin-4-one. InChIKey: HRORSVNZQWCZTD-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2,6-dipyridin-2-yl-1H-pyridin-4-one |
| InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=O)C=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)