CAS 128143-88-4 appears in our catalog under these names: 2,6–Bis(2–pyridyl)–4(1H)–pyridone, 2,6-Bis(2-pyridyl)-4(1h)-pyridone, 95%, 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE, 98%, 2,6-Bis(2-pyridyl)-4(1H)-pyridone, >98.0%(HPLC)(T), [2,2':6',2''-Terpyridin]-4'(1'H)-one, 96%, 96%. Offered by: GLPBio, Combi-blocks, Sigma-Aldrich, TCI, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
2,6-dipyridin-2-yl-1H-pyridin-4-one (CAS 128143-88-4) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 2,6-dipyridin-2-yl-1H-pyridin-4-one. InChIKey: HRORSVNZQWCZTD-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2,6-dipyridin-2-yl-1H-pyridin-4-one |
| InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=O)C=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)