CAS 4512-00-9 appears in our catalog under these names: 5,6-Diphenyl-1,2,4-triazin-3-ol, 95%, diphenyl-1,2,4-triazin-3-ol, 5,6-Diphenyl-1,2,4-triazin-3(2H)-one. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g.
5,6-diphenyl-2H-1,2,4-triazin-3-one (CAS 4512-00-9) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 5,6-diphenyl-2H-1,2,4-triazin-3-one. InChIKey: VTOJJDGNQGCRLP-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 5,6-diphenyl-2H-1,2,4-triazin-3-one |
| InChIKey | VTOJJDGNQGCRLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=O)NN=C2C3=CC=CC=C3 |
Computed by PubChem (NCBI)