CAS 248246-46-0 is the registry number for 1,11-Dihydro-10-methyl-2h-pyrimido[4,5-a]carbazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
10-methyl-1,3-dihydropyrimido[4,5-a]carbazol-2-one (CAS 248246-46-0) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 10-methyl-1,3-dihydropyrimido[4,5-a]carbazol-2-one. InChIKey: KNTLJZKTLJWQSN-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 10-methyl-1,3-dihydropyrimido[4,5-a]carbazol-2-one |
| InChIKey | KNTLJZKTLJWQSN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=C3C=CC4=CNC(=O)NC4=C3N=C12 |
Computed by PubChem (NCBI)