cas: 101003-65-0 — see every product listed under this CAS number, including other names
[2,2':6',2''-Terpyridin]-4'-ol, 98% (CAS 101003-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554876-250MG |
| cas | 101003-65-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 706.02 Pln | |
| Fluorochem | 5g | 2356.48 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dipyridin-2-yl-1H-pyridin-4-one (CAS 101003-65-0) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 2,6-dipyridin-2-yl-1H-pyridin-4-one. InChIKey: HRORSVNZQWCZTD-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2,6-dipyridin-2-yl-1H-pyridin-4-one |
| InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=O)C=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)