cas: 52382-48-6 — see every product listed under this CAS number, including other names
[2,2'-Bipyridine]-5,5'-diamine, 98% (CAS 52382-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F541440-100MG |
| cas | 52382-48-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1955.58 Pln | |
| Fluorochem | 10g | 3855.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-(5-amino-2-pyridinyl)pyridin-3-amine (CAS 52382-48-6) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 6-(5-amino-2-pyridinyl)pyridin-3-amine. InChIKey: QEIRCDAYPQFYBI-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-(5-amino-2-pyridinyl)pyridin-3-amine |
| InChIKey | QEIRCDAYPQFYBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1N)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)