cas: 52382-48-6 — see every product listed under this CAS number, including other names
5,5'-Diamino-2,2'-bipyridine, 98%, 98% (CAS 52382-48-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UG9-50mg |
| cas | 52382-48-6 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 981.20 Pln | |
| Chemat | 10g | 1850.00 Pln | |
| Chemat | 25g | 4403.60 Pln | |
| Chemat | 50g | 4485.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(5-amino-2-pyridinyl)pyridin-3-amine (CAS 52382-48-6) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 6-(5-amino-2-pyridinyl)pyridin-3-amine. InChIKey: QEIRCDAYPQFYBI-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-(5-amino-2-pyridinyl)pyridin-3-amine |
| InChIKey | QEIRCDAYPQFYBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1N)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)