cas: 1313737-75-5 — see every product listed under this CAS number, including other names
[2-[(4-Methylpiperidin-1-yl)methyl]phenyl]boranediol, 97%, 97% (CAS 1313737-75-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YHC-250mg |
| cas | 1313737-75-5 |
| size | 250mg |
| availability | 7.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 6266.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid (CAS 1313737-75-5) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: [2-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: PIRJBWDBULRMBB-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | [2-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | PIRJBWDBULRMBB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)