CAS 1032358-02-3 appears in our catalog under these names: 3,5-Dimethylpyridine-4-boronic acid pinacol ester, 95%, 3,5-Dimethylpyridine-4-boronic acid pinacol ester, 95% , 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98+%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 250mg, 500mg, 100mg, 1g, 5g, 10g, 25g.
3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1032358-02-3) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PLCYEDJFSPVVLL-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PLCYEDJFSPVVLL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2C)C |
Computed by PubChem (NCBI)