Products 1287753-40-5

CAS 1287753-40-5 is the registry number for [4-(1-Piperidin-1-ylethyl)phenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

[4-(1-piperidin-1-ylethyl)phenyl]boronic acid (CAS 1287753-40-5) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: [4-(1-piperidin-1-ylethyl)phenyl]boronic acid. InChIKey: AAVZQQFWPJUBCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20BNO2
Molecular weight233.12 g/mol
IUPAC name[4-(1-piperidin-1-ylethyl)phenyl]boronic acid
InChIKeyAAVZQQFWPJUBCQ-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C(C)N2CCCCC2)(O)O

Computed by PubChem (NCBI)