CAS 741709-60-4 appears in our catalog under these names: 2-Ethylpyridine-4-boronic acid pinacol ester, 95%, 2-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 2-ETHYLPYRIDINE-4-BORONIC ACID PINACOL ESTER, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 741709-60-4) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YYJPHWDHDLLAJH-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YYJPHWDHDLLAJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)CC |
Computed by PubChem (NCBI)