cas: 206055-86-9 — see every product listed under this CAS number, including other names
[3-(4-Methoxyphenyl)isoxazol-5-yl]methanol, 98%, 98% (CAS 206055-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AI4-100mg |
| cas | 206055-86-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1043.60 Pln | |
| Chemat | 10g | 1720.40 Pln | |
| Chemat | 25g | 3549.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol (CAS 206055-86-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol. InChIKey: SROFDUACOHNMJB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol |
| InChIKey | SROFDUACOHNMJB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)CO |
Computed by PubChem (NCBI)