cas: 206055-86-9 — see every product listed under this CAS number, including other names
[3-(4-Methoxyphenyl)isoxazol-5-yl]methanol, 98% (CAS 206055-86-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078792-250MG |
| cas | 206055-86-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1299.56 Pln | |
| Fluorochem | 10g | 2163.84 Pln | |
| Fluorochem | 25g | 4496.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol (CAS 206055-86-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol. InChIKey: SROFDUACOHNMJB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methanol |
| InChIKey | SROFDUACOHNMJB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)CO |
Computed by PubChem (NCBI)