cas: 1003843-94-4 — see every product listed under this CAS number, including other names
[3-Methanesulfonyl-5-(trifluoromethyl)phenyl]methanol, 97% (CAS 1003843-94-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621583-100MG |
| cas | 1003843-94-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1294.35 Pln | |
| Fluorochem | 250mg | 2122.19 Pln | |
| Fluorochem | 1g | 5194.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-methylsulfonyl-5-(trifluoromethyl)phenyl]methanol (CAS 1003843-94-4) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: [3-methylsulfonyl-5-(trifluoromethyl)phenyl]methanol. InChIKey: HBIQLOSUNLJCEF-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | [3-methylsulfonyl-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | HBIQLOSUNLJCEF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)