CAS 1262727-73-0 is the registry number for ETHYL 4-(TRIFLUOROMETHYL)BENZENESULFONATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl 4-(trifluoromethyl)benzenesulfonate (CAS 1262727-73-0) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: ethyl 4-(trifluoromethyl)benzenesulfonate. InChIKey: BIVDDFZOCLSYAV-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | ethyl 4-(trifluoromethyl)benzenesulfonate |
| InChIKey | BIVDDFZOCLSYAV-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)