CAS 255837-23-1 appears in our catalog under these names: Methanesulfonic acid, trifluoro-, 3,4-dimethylphenyl ester, 98%, 98%, 3,4-Dimethylphenyl triflate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3,4-dimethylphenyl) trifluoromethanesulfonate (CAS 255837-23-1) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: (3,4-dimethylphenyl) trifluoromethanesulfonate. InChIKey: NEZHQSLXAUSUTO-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | (3,4-dimethylphenyl) trifluoromethanesulfonate |
| InChIKey | NEZHQSLXAUSUTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OS(=O)(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)