Products 86364-02-5
CAS 86364-02-5 appears in our catalog under these names: Methanesulfonic acid, trifluoro-, 2,6-dimethylphenyl ester, 98%, 98%, 2,6-Dimethylphenyl trifluoromethanesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,6-dimethylphenyl) trifluoromethanesulfonate (CAS 86364-02-5) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: (2,6-dimethylphenyl) trifluoromethanesulfonate. InChIKey: ALJAHPWNRXXSSU-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | (2,6-dimethylphenyl) trifluoromethanesulfonate |
| InChIKey | ALJAHPWNRXXSSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)