cas: 133100-92-2 — see every product listed under this CAS number, including other names
[4-(Benzyloxy)phenyl]methanamine hydrochloride, 98%, 98% (CAS 133100-92-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BRPZ-10g |
| cas | 133100-92-2 |
| size | 10g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1062.80 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 25g | 2277.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-phenylmethoxyphenyl)methanamine;hydrochloride (CAS 133100-92-2) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (4-phenylmethoxyphenyl)methanamine;hydrochloride. InChIKey: RSZFCDGHJLBYEB-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)methanamine;hydrochloride |
| InChIKey | RSZFCDGHJLBYEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)