cas: 133100-92-2 — see every product listed under this CAS number, including other names
[4-(benzyloxy)phenyl]methanamine hydrochloride, 98% (CAS 133100-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F864105-1G |
| cas | 133100-92-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 25g | 2502.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-phenylmethoxyphenyl)methanamine;hydrochloride (CAS 133100-92-2) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (4-phenylmethoxyphenyl)methanamine;hydrochloride. InChIKey: RSZFCDGHJLBYEB-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)methanamine;hydrochloride |
| InChIKey | RSZFCDGHJLBYEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)