cas: 2096336-32-0 — see every product listed under this CAS number, including other names
[6-Chloro-5-(trifluoromethyl)pyridin-3-yl]boronic acid, 97% (CAS 2096336-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694467-100MG |
| cas | 2096336-32-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[6-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 2096336-32-0) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [6-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: GSOLWICWOIAQAW-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [6-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | GSOLWICWOIAQAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)