cas: 1373273-46-1 — see every product listed under this CAS number, including other names
{1-[(tert-Butoxy)carbonyl]pyrrolo[3,2-b]pyridin-2-yl}boronic acid, 98% (CAS 1373273-46-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694717-250MG |
| cas | 1373273-46-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1455.76 Pln | |
| Fluorochem | 5g | 4423.46 Pln | |
| Fluorochem | 10g | 8791.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid (CAS 1373273-46-1) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid. InChIKey: JYPXTBFIVPSJSL-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid |
| InChIKey | JYPXTBFIVPSJSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=N2)(O)O |
Computed by PubChem (NCBI)