Products 2399423-36-8
CAS 2399423-36-8 is the registry number for (3-{[(tert-Butoxy)carbonyl]amino}-5-cyanophenyl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2399423-36-8) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [3-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: PYVSSAMTQGDTHZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [3-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | PYVSSAMTQGDTHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)NC(=O)OC(C)(C)C)C#N)(O)O |
Computed by PubChem (NCBI)