cas: 926201-01-6 — see every product listed under this CAS number, including other names
{3-((pyridin-2-yl)methoxy)phenyl}methanamine, 95% (CAS 926201-01-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A997173-5g |
| cas | 926201-01-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7406.77 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(pyridin-2-ylmethoxy)phenyl]methanamine (CAS 926201-01-6) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: [3-(pyridin-2-ylmethoxy)phenyl]methanamine. InChIKey: FZQYAAFALDBUNJ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | [3-(pyridin-2-ylmethoxy)phenyl]methanamine |
| InChIKey | FZQYAAFALDBUNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=CC=CC(=C2)CN |
Computed by PubChem (NCBI)