CAS 954421-13-7 appears in our catalog under these names: (2E)-3-(Dimethylamino)-1-(1h-indol-3-yl)prop-2-en-1-one, 95%, (E)-3-(dimethylamino)-1-(1H-indol-3-yl)prop-2-en-1-one, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
(E)-3-(dimethylamino)-1-(1H-indol-3-yl)prop-2-en-1-one (CAS 954421-13-7) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(1H-indol-3-yl)prop-2-en-1-one. InChIKey: ZKAFMCYNLUNRHE-BQYQJAHWSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(1H-indol-3-yl)prop-2-en-1-one |
| InChIKey | ZKAFMCYNLUNRHE-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)