β-Alanyl-L-Tryptophan, ≥95%, ≥95%
cas: 21612-37-3 — see every product listed under this CAS number, including other names
β-Alanyl-L-Tryptophan, ≥95%, ≥95% (CAS 21612-37-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C53P-1g |
| cas | 21612-37-3 |
| size | 1g |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1326.80 Pln | |
| Chemat | 5g | 4283.60 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 21612-37-3) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: DZBHIIZGJUBURO-LBPRGKRZSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | DZBHIIZGJUBURO-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)