cas: 21612-37-3 — see every product listed under this CAS number, including other names
H-β-Ala-Trp-OH 95% (CAS 21612-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182989-100mg |
| cas | 21612-37-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1994.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A182989 |
(2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 21612-37-3) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: DZBHIIZGJUBURO-LBPRGKRZSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | DZBHIIZGJUBURO-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)