cas: 1485-92-3 — see every product listed under this CAS number, including other names
1',3',3'-Trimethylspiro[chromene-2,2'-indoline], 98% (CAS 1485-92-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720833-250MG |
| cas | 1485-92-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 1799.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1',3',3'-trimethylspiro[chromene-2,2'-indole] (CAS 1485-92-3) is a chemical compound with the molecular formula C19H19NO and a molecular weight of 277.4 g/mol. IUPAC name: 1',3',3'-trimethylspiro[chromene-2,2'-indole]. InChIKey: CZTCZDFGLUDUQP-UHFFFAOYSA-N.
| Molecular formula | C19H19NO |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 1',3',3'-trimethylspiro[chromene-2,2'-indole] |
| InChIKey | CZTCZDFGLUDUQP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=CC=CC=C4O3)C)C |
Computed by PubChem (NCBI)