Products 147199-40-4

CAS 147199-40-4 appears in our catalog under these names: Dapoxetine Impurity 28, (S)-N-Didemethyl Dapoxetine, Dapoxetine Impurity 3. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.

(1R)-3-naphthalen-1-yloxy-1-phenylpropan-1-amine (CAS 147199-40-4) is a chemical compound with the molecular formula C19H19NO and a molecular weight of 277.4 g/mol. IUPAC name: (1R)-3-naphthalen-1-yloxy-1-phenylpropan-1-amine. InChIKey: LLJKLSASLJIYAO-GOSISDBHSA-N.

Identity
Molecular formulaC19H19NO
Molecular weight277.4 g/mol
IUPAC name(1R)-3-naphthalen-1-yloxy-1-phenylpropan-1-amine
InChIKeyLLJKLSASLJIYAO-GOSISDBHSA-N
SMILESC1=CC=C(C=C1)[C@@H](CCOC2=CC=CC3=CC=CC=C32)N

Computed by PubChem (NCBI)