CAS 2568364-62-3 is the registry number for rel-(3S,4AR)-3-phenyl-1,2,3,4,4a,5-hexahydro-6H-pyrido[1,2-a]quinolin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4aR)-3-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one (CAS 2568364-62-3) is a chemical compound with the molecular formula C19H19NO and a molecular weight of 277.4 g/mol. IUPAC name: (3S,4aR)-3-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one. InChIKey: OGYRDFQNSIFRKY-JKSUJKDBSA-N.
| Molecular formula | C19H19NO |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (3S,4aR)-3-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one |
| InChIKey | OGYRDFQNSIFRKY-JKSUJKDBSA-N |
| SMILES | C1CN2[C@H](C[C@H]1C3=CC=CC=C3)CC(=O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)