Products 2568364-69-0
CAS 2568364-69-0 is the registry number for rel-(1S,4AS)-1-phenyl-1,2,3,4,4a,5-hexahydro-6H-pyrido[1,2-a]quinolin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4aS)-1-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one (CAS 2568364-69-0) is a chemical compound with the molecular formula C19H19NO and a molecular weight of 277.4 g/mol. IUPAC name: (1S,4aS)-1-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one. InChIKey: XNBHTXOUUTWXMP-RDJZCZTQSA-N.
| Molecular formula | C19H19NO |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (1S,4aS)-1-phenyl-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one |
| InChIKey | XNBHTXOUUTWXMP-RDJZCZTQSA-N |
| SMILES | C1C[C@H]2CC(=O)C3=CC=CC=C3N2[C@@H](C1)C4=CC=CC=C4 |
Computed by PubChem (NCBI)