cas: 1419101-03-3 — see every product listed under this CAS number, including other names
1(2H)-Pyridinecarboxylic acid, 3-fluoro-3,6-dihydro-, phenylmethyl ester, 97%, 97% (CAS 1419101-03-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HD5-100mg |
| cas | 1419101-03-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 500mg | 1034.00 Pln | |
| Chemat | 1g | 1552.40 Pln | |
| Chemat | 5g | 4466.00 Pln | |
| Chemat | 10g | 7389.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1419101-03-3) is a chemical compound with the molecular formula C13H14FNO2 and a molecular weight of 235.25 g/mol. IUPAC name: benzyl 3-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: WERNXLLMQDGBRF-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO2 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | benzyl 3-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | WERNXLLMQDGBRF-UHFFFAOYSA-N |
| SMILES | C1C=CC(CN1C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)