CAS 893642-00-7 is the registry number for N-Acetyl 2-fluoro-4-(3-hydroxy-3-methylbut-1-ynyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[2-fluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]acetamide (CAS 893642-00-7) is a chemical compound with the molecular formula C13H14FNO2 and a molecular weight of 235.25 g/mol. IUPAC name: N-[2-fluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]acetamide. InChIKey: JWGKUXZRKQDONQ-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO2 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | N-[2-fluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]acetamide |
| InChIKey | JWGKUXZRKQDONQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C#CC(C)(C)O)F |
Computed by PubChem (NCBI)