Products 1208459-96-4
CAS 1208459-96-4 appears in our catalog under these names: 1-Boc-6-Fluoro-1H-indole 98%, 1-Boc-6-Fluoro-1H-indole, 98%, 98%, 1-Boc-6-Fluoro-1H-indole, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl 6-fluoroindole-1-carboxylate (CAS 1208459-96-4) is a chemical compound with the molecular formula C13H14FNO2 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 6-fluoroindole-1-carboxylate. InChIKey: JYJYZNQHVVDOIE-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO2 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | tert-butyl 6-fluoroindole-1-carboxylate |
| InChIKey | JYJYZNQHVVDOIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)F |
Computed by PubChem (NCBI)